Difference between revisions of "3-HEXAPRENYL-4-HYDROXY-5-METHOXYBENZOATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ21192 == * transcription-direction: ** negative * right-end-position: ** 37862 * left-end-position: ** 11125 * centisome-position: ** 5.645403...")
 
(Created page with "Category:metabolite == Metabolite 3-HEXAPRENYL-4-HYDROXY-5-METHOXYBENZOATE == * common-name: ** 3-methoxy-4-hydroxy-5-all-trans-hexaprenylbenzoate * smiles: ** cc(=cccc(=c...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ21192 ==
+
== Metabolite 3-HEXAPRENYL-4-HYDROXY-5-METHOXYBENZOATE ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** 3-methoxy-4-hydroxy-5-all-trans-hexaprenylbenzoate
−
* right-end-position:
+
* smiles:
−
** 37862
+
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(c([o-])=o)=c1)o))c)c)c)c)c)c
−
* left-end-position:
+
* inchi-key:
−
** 11125
+
** yszsvgfmajxgmq-fricuitqsa-m
−
* centisome-position:
+
* molecular-weight:
−
** 5.645403   
+
** 575.85
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
== Reaction(s) known to produce the compound ==
−
== Reaction(s) associated ==
+
* [[2.1.1.114-RXN]]
−
* [[3.4.21.102-RXN]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=3-methoxy-4-hydroxy-5-all-trans-hexaprenylbenzoate}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=yszsvgfmajxgmq-fricuitqsa-m}}
−
** Category: [[orthology]]
+
{{#set: molecular-weight=575.85}}
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=37862}}
 
−
{{#set: left-end-position=11125}}
 
−
{{#set: centisome-position=5.645403    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=1}}
 

Latest revision as of 11:14, 18 March 2021

Metabolite 3-HEXAPRENYL-4-HYDROXY-5-METHOXYBENZOATE

  • common-name:
    • 3-methoxy-4-hydroxy-5-all-trans-hexaprenylbenzoate
  • smiles:
    • cc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(c([o-])=o)=c1)o))c)c)c)c)c)c
  • inchi-key:
    • yszsvgfmajxgmq-fricuitqsa-m
  • molecular-weight:
    • 575.85

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=3-HEXAPRENYL-4-HYDROXY-5-METHOXYBENZOATE&oldid=138261"