Difference between revisions of "3-HEXAPRENYL-4-HYDROXYBENZOATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-2181 == * common-name: ** 1-oleoyl-2-oleoyl-phosphatidylcholine * smiles: ** ccccccccc=ccccccccc(occ(oc(=o)cccccccc=ccccccccc)cop([o-...")
(Created page with "Category:metabolite == Metabolite CPD-13578 == * common-name: ** aminomethylpyrimidine * smiles: ** cc1(=nc(=c(c[n+])c=n1)n) * inchi-key: ** ozohtvfcskfmll-uhfffaoysa-o *...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-2181 ==
+
== Metabolite CPD-13578 ==
 
* common-name:
 
* common-name:
** 1-oleoyl-2-oleoyl-phosphatidylcholine
+
** aminomethylpyrimidine
 
* smiles:
 
* smiles:
** ccccccccc=ccccccccc(occ(oc(=o)cccccccc=ccccccccc)cop([o-])(=o)occ[n+](c)(c)c)=o
+
** cc1(=nc(=c(c[n+])c=n1)n)
 
* inchi-key:
 
* inchi-key:
** snkawjbjqdlsff-nvkmucnasa-n
+
** ozohtvfcskfmll-uhfffaoysa-o
 
* molecular-weight:
 
* molecular-weight:
** 786.123
+
** 139.18
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8320]]
+
* [[RXN-12613]]
* [[RXN-8327]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-oleoyl-2-oleoyl-phosphatidylcholine}}
+
{{#set: common-name=aminomethylpyrimidine}}
{{#set: inchi-key=inchikey=snkawjbjqdlsff-nvkmucnasa-n}}
+
{{#set: inchi-key=inchikey=ozohtvfcskfmll-uhfffaoysa-o}}
{{#set: molecular-weight=786.123}}
+
{{#set: molecular-weight=139.18}}

Revision as of 14:55, 5 January 2021

Metabolite CPD-13578

  • common-name:
    • aminomethylpyrimidine
  • smiles:
    • cc1(=nc(=c(c[n+])c=n1)n)
  • inchi-key:
    • ozohtvfcskfmll-uhfffaoysa-o
  • molecular-weight:
    • 139.18

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality