|
|
| (9 intermediate revisions by 5 users not shown) |
| Line 1: |
Line 1: |
| − | [[Category:gene]] | + | [[Category:metabolite]] |
| − | == Gene SJ14909 == | + | == Metabolite 3-HEXAPRENYL-4-HYDROXYBENZOATE == |
| − | * transcription-direction: | + | * common-name: |
| − | ** negative | + | ** 3-hexaprenyl-4-hydroxybenzoate |
| − | * right-end-position:
| + | * smiles: |
| − | ** 136760
| + | ** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(o)c=cc(c(=o)[o-])=c1))c)c)c)c)c |
| − | * left-end-position:
| + | * inchi-key: |
| − | ** 133149 | + | ** lkmqqqabigihgl-laaqxviisa-m |
| − | * centisome-position:
| + | * molecular-weight: |
| − | ** 43.70083 | + | ** 545.824 |
| − | == Organism(s) associated with this gene == | + | == Reaction(s) known to consume the compound == |
| − | * [[S.japonica_carotenoid_curated]]
| + | == Reaction(s) known to produce the compound == |
| − | == Reaction(s) associated == | + | * [[RXN-9003]] |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| + | == Reaction(s) of unknown directionality == |
| − | * [[GLUTATHIONE-PEROXIDASE-RXN]]
| + | {{#set: common-name=3-hexaprenyl-4-hydroxybenzoate}} |
| − | ** Category: [[annotation]]
| + | {{#set: inchi-key=inchikey=lkmqqqabigihgl-laaqxviisa-m}} |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| + | {{#set: molecular-weight=545.824}} |
| − | * [[GSHTRAN-RXN]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
| |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[GST-RXN]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | ** Category: [[orthology]] | |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[LEUKOTRIENE-C4-SYNTHASE-RXN]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | |
| − | * [[PEROXID-RXN]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[RXN-13673]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a | |
| − | * [[RXN-14240]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | |
| − | * [[RXN-15288]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[RXN-15680]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[RXN-17352]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[RXN-8635]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | </div>
| |
| − | == Pathway(s) associated == | |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| |
| − | * [[DETOX1-PWY-1]]
| |
| − | ** '''4''' reactions found over '''4''' reactions in the full pathway
| |
| − | * [[PWY-4081]] | |
| − | ** '''3''' reactions found over '''3''' reactions in the full pathway
| |
| − | * [[PWY-6842]]
| |
| − | ** '''5''' reactions found over '''9''' reactions in the full pathway
| |
| − | * [[PWY-4061]]
| |
| − | ** '''4''' reactions found over '''8''' reactions in the full pathway
| |
| − | * [[PWY66-375]]
| |
| − | ** '''5''' reactions found over '''6''' reactions in the full pathway
| |
| − | * [[PWY-7112]]
| |
| − | ** '''3''' reactions found over '''4''' reactions in the full pathway
| |
| − | * [[PWY-7214]]
| |
| − | ** '''1''' reactions found over '''2''' reactions in the full pathway
| |
| − | * [[PWY-7445]]
| |
| − | ** '''1''' reactions found over '''4''' reactions in the full pathway
| |
| − | * [[PWY-7533]]
| |
| − | ** '''3''' reactions found over '''9''' reactions in the full pathway
| |
| − | * [[PWY-5466]]
| |
| − | ** '''2''' reactions found over '''10''' reactions in the full pathway
| |
| − | * [[PWY-6824]]
| |
| − | ** '''2''' reactions found over '''10''' reactions in the full pathway
| |
| − | * [[PWY-5469]]
| |
| − | ** '''2''' reactions found over '''8''' reactions in the full pathway
| |
| − | * [[PWY-5461]]
| |
| − | ** '''1''' reactions found over '''1''' reactions in the full pathway
| |
| − | </div>
| |
| − | {{#set: transcription-direction=negative}} | |
| − | {{#set: right-end-position=136760}} | |
| − | {{#set: left-end-position=133149}}
| |
| − | {{#set: centisome-position=43.70083 }} | |
| − | {{#set: organism associated=S.japonica_carotenoid_curated}}
| |
| − | {{#set: nb reaction associated=11}}
| |
| − | {{#set: nb pathway associated=13}}
| |
