Difference between revisions of "3-HEXAPRENYL-45-DIHYDROXYBENZOATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ04321 == * transcription-direction: ** positive * right-end-position: ** 462999 * left-end-position: ** 457643 * centisome-position: ** 47.02596...")
(Created page with "Category:metabolite == Metabolite 3-HEXAPRENYL-45-DIHYDROXYBENZOATE == * common-name: ** 3,4-dihydroxy-5-all-trans-hexaprenylbenzoate * smiles: ** cc(=cccc(=cccc(=cccc(=cc...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ04321 ==
+
== Metabolite 3-HEXAPRENYL-45-DIHYDROXYBENZOATE ==
* transcription-direction:
+
* common-name:
** positive
+
** 3,4-dihydroxy-5-all-trans-hexaprenylbenzoate
* right-end-position:
+
* smiles:
** 462999
+
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(=cc(c([o-])=o)=c1)o)o))c)c)c)c)c)c
* left-end-position:
+
* inchi-key:
** 457643
+
** vepicjbqcouqpi-irvxxiiisa-m
* centisome-position:
+
* molecular-weight:
** 47.02596   
+
** 561.823
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[2.1.1.114-RXN]]
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
* [[2.1.1.127-RXN]]
+
== Reaction(s) of unknown directionality ==
** Category: [[annotation]]
+
{{#set: common-name=3,4-dihydroxy-5-all-trans-hexaprenylbenzoate}}
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=vepicjbqcouqpi-irvxxiiisa-m}}
* [[RXN-13588]]
+
{{#set: molecular-weight=561.823}}
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
{{#set: transcription-direction=positive}}
 
{{#set: right-end-position=462999}}
 
{{#set: left-end-position=457643}}
 
{{#set: centisome-position=47.02596    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=2}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite 3-HEXAPRENYL-45-DIHYDROXYBENZOATE

  • common-name:
    • 3,4-dihydroxy-5-all-trans-hexaprenylbenzoate
  • smiles:
    • cc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(=cc(c([o-])=o)=c1)o)o))c)c)c)c)c)c
  • inchi-key:
    • vepicjbqcouqpi-irvxxiiisa-m
  • molecular-weight:
    • 561.823

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality