Difference between revisions of "3-HYDROXY-ISOBUTYRYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 2-METHYL-3-PHYTYL-14-NAPHTHOQUINONE == * common-name: ** phylloquinone * smiles: ** cc(c)cccc(c)cccc(c)cccc(c)=ccc2(=c(c(=o)c1(c=cc=cc=1c...")
(Created page with "Category:metabolite == Metabolite 3-HYDROXY-ISOBUTYRYL-COA == * common-name: ** 3-hydroxy-isobutanoyl-coa == Reaction(s) known to consume the compound == * RXN-13721 =...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 2-METHYL-3-PHYTYL-14-NAPHTHOQUINONE ==
+
== Metabolite 3-HYDROXY-ISOBUTYRYL-COA ==
 
* common-name:
 
* common-name:
** phylloquinone
+
** 3-hydroxy-isobutanoyl-coa
* smiles:
 
** cc(c)cccc(c)cccc(c)cccc(c)=ccc2(=c(c(=o)c1(c=cc=cc=1c2=o))c)
 
* inchi-key:
 
** mbwxntaxlnyfjb-lkudqcmesa-n
 
* molecular-weight:
 
** 450.703
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1.1.4.1-RXN]]
+
* [[RXN-13721]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.1.4.1-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=phylloquinone}}
+
{{#set: common-name=3-hydroxy-isobutanoyl-coa}}
{{#set: inchi-key=inchikey=mbwxntaxlnyfjb-lkudqcmesa-n}}
 
{{#set: molecular-weight=450.703}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite 3-HYDROXY-ISOBUTYRYL-COA

  • common-name:
    • 3-hydroxy-isobutanoyl-coa

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality