Difference between revisions of "3-HYDROXY-ISOBUTYRYL-COA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite SINAPYL-ALCOHOL == * common-name: ** sinapyl alcohol * smiles: ** coc1(c=c(c=cco)c=c(oc)c(o)=1) * inchi-key: ** lzfopexouvtgjs-onegzznksa...") |
(Created page with "Category:metabolite == Metabolite 3-HYDROXY-ISOBUTYRYL-COA == * common-name: ** 3-hydroxy-isobutanoyl-coa == Reaction(s) known to consume the compound == * RXN-13721 =...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite 3-HYDROXY-ISOBUTYRYL-COA == |
* common-name: | * common-name: | ||
− | ** | + | ** 3-hydroxy-isobutanoyl-coa |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-13721]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=3-hydroxy-isobutanoyl-coa}} |
− | |||
− |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite 3-HYDROXY-ISOBUTYRYL-COA
- common-name:
- 3-hydroxy-isobutanoyl-coa