Difference between revisions of "3-HYDROXY-ISOVALERYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite BILIVERDINE == * common-name: ** biliverdin-ix-α * smiles: ** c=cc1(c(nc(c(c)=1)=o)=cc4(=c(c)c(=c(c=c3(n=c(c=c2(c(c)=c(c=c)c(n2)=o)...")
(Created page with "Category:metabolite == Metabolite 3-HYDROXY-ISOVALERYL-COA == * common-name: ** 3-hydroxyisovaleryl-coa * smiles: ** cc(cop(=o)([o-])op(=o)([o-])occ3(c(c(c(n2(c=nc1(c(=nc=...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite BILIVERDINE ==
+
== Metabolite 3-HYDROXY-ISOVALERYL-COA ==
 
* common-name:
 
* common-name:
** biliverdin-ix-α
+
** 3-hydroxyisovaleryl-coa
 
* smiles:
 
* smiles:
** c=cc1(c(nc(c(c)=1)=o)=cc4(=c(c)c(=c(c=c3(n=c(c=c2(c(c)=c(c=c)c(n2)=o))c(c)=c3ccc([o-])=o))n4)ccc([o-])=o))
+
** cc(cop(=o)([o-])op(=o)([o-])occ3(c(c(c(n2(c=nc1(c(=nc=nc=12)n)))o3)o)op([o-])([o-])=o))(c)c(c(nccc(nccsc(=o)cc(c)(c)o)=o)=o)o
 
* inchi-key:
 
* inchi-key:
** qbuvfdktzjnupp-msgwkzgbsa-l
+
** pevzkilcbdeobt-uhfffaoysa-j
 
* molecular-weight:
 
* molecular-weight:
** 580.639
+
** 863.619
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1.3.7.2-RXN]]
+
* [[ECH_LPAREN_3hivcoa_RPAREN_]]
* [[1.3.7.4-RXN]]
+
* [[RXN-14266]]
* [[R05818]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[HEME-OXYGENASE-DECYCLIZING-RXN]]
+
* [[ECH_LPAREN_3hivcoa_RPAREN_]]
* [[R05818]]
+
* [[RXN-14266]]
* [[RXN-17523]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=biliverdin-ix-α}}
+
{{#set: common-name=3-hydroxyisovaleryl-coa}}
{{#set: inchi-key=inchikey=qbuvfdktzjnupp-msgwkzgbsa-l}}
+
{{#set: inchi-key=inchikey=pevzkilcbdeobt-uhfffaoysa-j}}
{{#set: molecular-weight=580.639}}
+
{{#set: molecular-weight=863.619}}

Latest revision as of 11:12, 18 March 2021

Metabolite 3-HYDROXY-ISOVALERYL-COA

  • common-name:
    • 3-hydroxyisovaleryl-coa
  • smiles:
    • cc(cop(=o)([o-])op(=o)([o-])occ3(c(c(c(n2(c=nc1(c(=nc=nc=12)n)))o3)o)op([o-])([o-])=o))(c)c(c(nccc(nccsc(=o)cc(c)(c)o)=o)=o)o
  • inchi-key:
    • pevzkilcbdeobt-uhfffaoysa-j
  • molecular-weight:
    • 863.619

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality