Difference between revisions of "3-HYDROXY-L-KYNURENINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ12355 == * transcription-direction: ** positive * right-end-position: ** 298149 * left-end-position: ** 286639 * centisome-position: ** 79.65624...")
(Created page with "Category:metabolite == Metabolite 3-HYDROXY-L-KYNURENINE == * common-name: ** 3-hydroxy-l-kynurenine * smiles: ** c([o-])(=o)c([n+])cc(=o)c1(=c(n)c(o)=cc=c1) * inchi-key:...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ12355 ==
+
== Metabolite 3-HYDROXY-L-KYNURENINE ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** 3-hydroxy-l-kynurenine
−
* right-end-position:
+
* smiles:
−
** 298149
+
** c([o-])(=o)c([n+])cc(=o)c1(=c(n)c(o)=cc=c1)
−
* left-end-position:
+
* inchi-key:
−
** 286639
+
** vckpuufaignjhc-lurjtmiesa-n
−
* centisome-position:
+
* molecular-weight:
−
** 79.65624   
+
** 224.216
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-10721]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
* [[RIBITOL-2-DEHYDROGENASE-RXN]]
+
* [[KYNURENINE-3-MONOOXYGENASE-RXN]]
−
** Category: [[orthology]]
+
* [[RXN-10721]]
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
== Reaction(s) of unknown directionality ==
−
* [[RXN-5285]]
+
{{#set: common-name=3-hydroxy-l-kynurenine}}
−
** Category: [[annotation]]
+
{{#set: inchi-key=inchikey=vckpuufaignjhc-lurjtmiesa-n}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: molecular-weight=224.216}}
−
* [[RXN1F-10]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[RIBITOLUTIL-PWY]]
 
−
** '''1''' reactions found over '''2''' reactions in the full pathway
 
−
* [[CHLOROPHYLL-SYN]]
 
−
** '''6''' reactions found over '''9''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=298149}}
 
−
{{#set: left-end-position=286639}}
 
−
{{#set: centisome-position=79.65624    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=3}}
 
−
{{#set: nb pathway associated=2}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite 3-HYDROXY-L-KYNURENINE

  • common-name:
    • 3-hydroxy-l-kynurenine
  • smiles:
    • c([o-])(=o)c([n+])cc(=o)c1(=c(n)c(o)=cc=c1)
  • inchi-key:
    • vckpuufaignjhc-lurjtmiesa-n
  • molecular-weight:
    • 224.216

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=3-HYDROXY-L-KYNURENINE&oldid=136685"