Difference between revisions of "3-HYDROXY-L-KYNURENINE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ12355 == * transcription-direction: ** positive * right-end-position: ** 298149 * left-end-position: ** 286639 * centisome-position: ** 79.65624...") |
(Created page with "Category:metabolite == Metabolite 3-HYDROXY-L-KYNURENINE == * common-name: ** 3-hydroxy-l-kynurenine * smiles: ** c([o-])(=o)c([n+])cc(=o)c1(=c(n)c(o)=cc=c1) * inchi-key:...") |
||
(8 intermediate revisions by 4 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite 3-HYDROXY-L-KYNURENINE == |
− | * | + | * common-name: |
− | ** | + | ** 3-hydroxy-l-kynurenine |
− | * | + | * smiles: |
− | ** | + | ** c([o-])(=o)c([n+])cc(=o)c1(=c(n)c(o)=cc=c1) |
− | * | + | * inchi-key: |
− | ** | + | ** vckpuufaignjhc-lurjtmiesa-n |
− | * | + | * molecular-weight: |
− | ** | + | ** 224.216 |
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-10721]] |
− | == Reaction(s) | + | == Reaction(s) known to produce the compound == |
− | * [[ | + | * [[KYNURENINE-3-MONOOXYGENASE-RXN]] |
− | + | * [[RXN-10721]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | * [[RXN- | + | {{#set: common-name=3-hydroxy-l-kynurenine}} |
− | + | {{#set: inchi-key=inchikey=vckpuufaignjhc-lurjtmiesa-n}} | |
− | + | {{#set: molecular-weight=224.216}} | |
− | |||
− | |||
− | |||
− | == | ||
− | |||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite 3-HYDROXY-L-KYNURENINE
- common-name:
- 3-hydroxy-l-kynurenine
- smiles:
- c([o-])(=o)c([n+])cc(=o)c1(=c(n)c(o)=cc=c1)
- inchi-key:
- vckpuufaignjhc-lurjtmiesa-n
- molecular-weight:
- 224.216