Difference between revisions of "3-HYDROXY-L-KYNURENINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Protein-S-farnesyl-L-cysteines == * common-name: ** a [protein] s-farnesyl-l-cysteine == Reaction(s) known to consume the compound == * [...")
(Created page with "Category:metabolite == Metabolite 3-HYDROXY-L-KYNURENINE == * common-name: ** 3-hydroxy-l-kynurenine * smiles: ** c([o-])(=o)c([n+])cc(=o)c1(=c(n)c(o)=cc=c1) * inchi-key:...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Protein-S-farnesyl-L-cysteines ==
+
== Metabolite 3-HYDROXY-L-KYNURENINE ==
 
* common-name:
 
* common-name:
** a [protein] s-farnesyl-l-cysteine
+
** 3-hydroxy-l-kynurenine
 +
* smiles:
 +
** c([o-])(=o)c([n+])cc(=o)c1(=c(n)c(o)=cc=c1)
 +
* inchi-key:
 +
** vckpuufaignjhc-lurjtmiesa-n
 +
* molecular-weight:
 +
** 224.216
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.5.1.58-RXN]]
+
* [[RXN-10721]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.5.1.58-RXN]]
+
* [[KYNURENINE-3-MONOOXYGENASE-RXN]]
 +
* [[RXN-10721]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a [protein] s-farnesyl-l-cysteine}}
+
{{#set: common-name=3-hydroxy-l-kynurenine}}
 +
{{#set: inchi-key=inchikey=vckpuufaignjhc-lurjtmiesa-n}}
 +
{{#set: molecular-weight=224.216}}

Latest revision as of 11:11, 18 March 2021

Metabolite 3-HYDROXY-L-KYNURENINE

  • common-name:
    • 3-hydroxy-l-kynurenine
  • smiles:
    • c([o-])(=o)c([n+])cc(=o)c1(=c(n)c(o)=cc=c1)
  • inchi-key:
    • vckpuufaignjhc-lurjtmiesa-n
  • molecular-weight:
    • 224.216

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality