Difference between revisions of "3-HYDROXY-N6N6N6-TRIMETHYL-L-LYSINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=PGMTh PGMTh] == * direction: ** reversible * common-name: ** phosphoglucomutase, chloroplast == Rea...")
(Created page with "Category:metabolite == Metabolite 3-HYDROXY-N6N6N6-TRIMETHYL-L-LYSINE == * common-name: ** 3-hydroxy-n6,n6,n6-trimethyl-l-lysine * smiles: ** c[n+](cccc(c(c([o-])=o)[n+])o...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=PGMTh PGMTh] ==
+
== Metabolite 3-HYDROXY-N6N6N6-TRIMETHYL-L-LYSINE ==
−
* direction:
 
−
** reversible
 
 
* common-name:
 
* common-name:
−
** phosphoglucomutase, chloroplast
+
** 3-hydroxy-n6,n6,n6-trimethyl-l-lysine
−
== Reaction formula ==
+
* smiles:
−
* 1.0 [[GLC-1-P]][h] '''<=>''' 1.0 [[ALPHA-GLC-6-P]][h]
+
** c[n+](cccc(c(c([o-])=o)[n+])o)(c)c
−
== Gene(s) associated with this reaction  ==
+
* inchi-key:
−
* Gene: [[SJ12510]]
+
** zrjhlgyvucpznh-mqwkrirwsa-o
−
** Category: [[orthology]]
+
* molecular-weight:
−
*** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
** 205.276
−
* Gene: [[SJ18341]]
+
== Reaction(s) known to consume the compound ==
−
** Category: [[orthology]]
+
* [[RXN-9896]]
−
*** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
== Reaction(s) known to produce the compound ==
−
== Pathway(s) ==
+
* [[TRIMETHYLLYSINE-DIOXYGENASE-RXN]]
−
== Reconstruction information  ==
+
== Reaction(s) of unknown directionality ==
−
* category: [[orthology]]; source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
+
{{#set: common-name=3-hydroxy-n6,n6,n6-trimethyl-l-lysine}}
−
== External links  ==
+
{{#set: inchi-key=inchikey=zrjhlgyvucpznh-mqwkrirwsa-o}}
−
{{#set: direction=reversible}}
+
{{#set: molecular-weight=205.276}}
−
{{#set: common-name=phosphoglucomutase, chloroplast}}
 
−
{{#set: nb gene associated=2}}
 
−
{{#set: nb pathway associated=0}}
 
−
{{#set: reconstruction category=orthology}}
 
−
{{#set: reconstruction tool=pantograph}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_nannochloropsis_salina}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite 3-HYDROXY-N6N6N6-TRIMETHYL-L-LYSINE

  • common-name:
    • 3-hydroxy-n6,n6,n6-trimethyl-l-lysine
  • smiles:
    • c[n+](cccc(c(c([o-])=o)[n+])o)(c)c
  • inchi-key:
    • zrjhlgyvucpznh-mqwkrirwsa-o
  • molecular-weight:
    • 205.276

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=3-HYDROXY-N6N6N6-TRIMETHYL-L-LYSINE&oldid=138880"