Difference between revisions of "3-HYDROXY-N6N6N6-TRIMETHYL-L-LYSINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8630 == * common-name: ** a 5'-diphospho-purine-[mrna] == Reaction(s) known to consume the compound == * MRNA-GUANYLYLTRANSFERASE-R...")
(Created page with "Category:metabolite == Metabolite 3-HYDROXY-N6N6N6-TRIMETHYL-L-LYSINE == * common-name: ** 3-hydroxy-n6,n6,n6-trimethyl-l-lysine * smiles: ** c[n+](cccc(c(c([o-])=o)[n+])o...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-8630 ==
+
== Metabolite 3-HYDROXY-N6N6N6-TRIMETHYL-L-LYSINE ==
 
* common-name:
 
* common-name:
** a 5'-diphospho-purine-[mrna]
+
** 3-hydroxy-n6,n6,n6-trimethyl-l-lysine
 +
* smiles:
 +
** c[n+](cccc(c(c([o-])=o)[n+])o)(c)c
 +
* inchi-key:
 +
** zrjhlgyvucpznh-mqwkrirwsa-o
 +
* molecular-weight:
 +
** 205.276
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[MRNA-GUANYLYLTRANSFERASE-RXN]]
+
* [[RXN-9896]]
* [[RXN-12826]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[POLYNUCLEOTIDE-5-PHOSPHATASE-RXN]]
+
* [[TRIMETHYLLYSINE-DIOXYGENASE-RXN]]
* [[RXN-12826]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a 5'-diphospho-purine-[mrna]}}
+
{{#set: common-name=3-hydroxy-n6,n6,n6-trimethyl-l-lysine}}
 +
{{#set: inchi-key=inchikey=zrjhlgyvucpznh-mqwkrirwsa-o}}
 +
{{#set: molecular-weight=205.276}}

Latest revision as of 11:15, 18 March 2021

Metabolite 3-HYDROXY-N6N6N6-TRIMETHYL-L-LYSINE

  • common-name:
    • 3-hydroxy-n6,n6,n6-trimethyl-l-lysine
  • smiles:
    • c[n+](cccc(c(c([o-])=o)[n+])o)(c)c
  • inchi-key:
    • zrjhlgyvucpznh-mqwkrirwsa-o
  • molecular-weight:
    • 205.276

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality