Difference between revisions of "3-HYDROXY-N6N6N6-TRIMETHYL-L-LYSINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Heparan-sulfate-3-N-disulfate == * common-name: ** a [heparan sulfate]-α-d-n-sulfoglucosamine 3-o-sulfate == Reaction(s) known to c...") |
(Created page with "Category:metabolite == Metabolite CPD-374 == * common-name: ** sepiapterin * smiles: ** cc(o)c(=o)c1(cnc2(n=c(n)nc(=o)c(n=1)=2)) * inchi-key: ** vpvoxuspxfpwbn-vkhmyheasa-...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-374 == |
* common-name: | * common-name: | ||
− | ** | + | ** sepiapterin |
+ | * smiles: | ||
+ | ** cc(o)c(=o)c1(cnc2(n=c(n)nc(=o)c(n=1)=2)) | ||
+ | * inchi-key: | ||
+ | ** vpvoxuspxfpwbn-vkhmyheasa-n | ||
+ | * molecular-weight: | ||
+ | ** 237.218 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[SEPIAPTERIN-REDUCTASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[SEPIAPTERIN-REDUCTASE-RXN]] |
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=sepiapterin}} |
+ | {{#set: inchi-key=inchikey=vpvoxuspxfpwbn-vkhmyheasa-n}} | ||
+ | {{#set: molecular-weight=237.218}} |
Revision as of 13:11, 14 January 2021
Contents
Metabolite CPD-374
- common-name:
- sepiapterin
- smiles:
- cc(o)c(=o)c1(cnc2(n=c(n)nc(=o)c(n=1)=2))
- inchi-key:
- vpvoxuspxfpwbn-vkhmyheasa-n
- molecular-weight:
- 237.218