Difference between revisions of "3-HYDROXY-N6N6N6-TRIMETHYL-L-LYSINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-5881 == * common-name: ** (6r)-4a-hydroxy-tetrahydrobiopterin * smiles: ** cc(o)c(o)[ch]1(cnc2(=nc(n)=nc(=o)c(o)(n1)2)) * inchi-key:...")
(Created page with "Category:metabolite == Metabolite 3-HYDROXY-N6N6N6-TRIMETHYL-L-LYSINE == * common-name: ** 3-hydroxy-n6,n6,n6-trimethyl-l-lysine * smiles: ** c[n+](cccc(c(c([o-])=o)[n+])o...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite CPD-5881 ==
+
== Metabolite 3-HYDROXY-N6N6N6-TRIMETHYL-L-LYSINE ==
 
* common-name:
 
* common-name:
−
** (6r)-4a-hydroxy-tetrahydrobiopterin
+
** 3-hydroxy-n6,n6,n6-trimethyl-l-lysine
 
* smiles:
 
* smiles:
−
** cc(o)c(o)[ch]1(cnc2(=nc(n)=nc(=o)c(o)(n1)2))
+
** c[n+](cccc(c(c([o-])=o)[n+])o)(c)c
 
* inchi-key:
 
* inchi-key:
−
** kjkiefupappgbc-xxkocqoqsa-n
+
** zrjhlgyvucpznh-mqwkrirwsa-o
 
* molecular-weight:
 
* molecular-weight:
−
** 257.249
+
** 205.276
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-7908]]
+
* [[RXN-9896]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[TRIMETHYLLYSINE-DIOXYGENASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=(6r)-4a-hydroxy-tetrahydrobiopterin}}
+
{{#set: common-name=3-hydroxy-n6,n6,n6-trimethyl-l-lysine}}
−
{{#set: inchi-key=inchikey=kjkiefupappgbc-xxkocqoqsa-n}}
+
{{#set: inchi-key=inchikey=zrjhlgyvucpznh-mqwkrirwsa-o}}
−
{{#set: molecular-weight=257.249}}
+
{{#set: molecular-weight=205.276}}

Latest revision as of 11:15, 18 March 2021

Metabolite 3-HYDROXY-N6N6N6-TRIMETHYL-L-LYSINE

  • common-name:
    • 3-hydroxy-n6,n6,n6-trimethyl-l-lysine
  • smiles:
    • c[n+](cccc(c(c([o-])=o)[n+])o)(c)c
  • inchi-key:
    • zrjhlgyvucpznh-mqwkrirwsa-o
  • molecular-weight:
    • 205.276

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=3-HYDROXY-N6N6N6-TRIMETHYL-L-LYSINE&oldid=138880"