Difference between revisions of "3-HYDROXYADIPYL-COA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8166 == * common-name: ** 1-18:2-2-18:3-monogalactosyldiacylglycerol * smiles: ** cccccc=ccc=ccccccccc(occ(coc1(oc(co)c(o)c(o)c(o)1))...") |
(Created page with "Category:metabolite == Metabolite 3-HYDROXYADIPYL-COA == * common-name: ** (3s)-hydroxyadipyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(cc(ccc(=o)[o-])o)=o)cop(=o)(op(...") |
||
(5 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite 3-HYDROXYADIPYL-COA == |
* common-name: | * common-name: | ||
− | ** | + | ** (3s)-hydroxyadipyl-coa |
* smiles: | * smiles: | ||
− | ** | + | ** cc(c)(c(o)c(=o)nccc(=o)nccsc(cc(ccc(=o)[o-])o)=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** oteacgaedcimbs-notshufbsa-i |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 906.621 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-2425]] |
+ | * [[RXN0-2044]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-2425]] |
+ | * [[RXN0-2044]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=(3s)-hydroxyadipyl-coa}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=oteacgaedcimbs-notshufbsa-i}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=906.621}} |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite 3-HYDROXYADIPYL-COA
- common-name:
- (3s)-hydroxyadipyl-coa
- smiles:
- cc(c)(c(o)c(=o)nccc(=o)nccsc(cc(ccc(=o)[o-])o)=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- oteacgaedcimbs-notshufbsa-i
- molecular-weight:
- 906.621