Difference between revisions of "3-HYDROXYADIPYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8166 == * common-name: ** 1-18:2-2-18:3-monogalactosyldiacylglycerol * smiles: ** cccccc=ccc=ccccccccc(occ(coc1(oc(co)c(o)c(o)c(o)1))...")
(Created page with "Category:metabolite == Metabolite 3-HYDROXYADIPYL-COA == * common-name: ** (3s)-hydroxyadipyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(cc(ccc(=o)[o-])o)=o)cop(=o)(op(...")
 
(4 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-8166 ==
+
== Metabolite 3-HYDROXYADIPYL-COA ==
 
* common-name:
 
* common-name:
** 1-18:2-2-18:3-monogalactosyldiacylglycerol
+
** (3s)-hydroxyadipyl-coa
 
* smiles:
 
* smiles:
** cccccc=ccc=ccccccccc(occ(coc1(oc(co)c(o)c(o)c(o)1))oc(=o)cccccccc=ccc=ccc=ccc)=o
+
** cc(c)(c(o)c(=o)nccc(=o)nccsc(cc(ccc(=o)[o-])o)=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** drlqfbrxasrgdp-bubqrnscsa-n
+
** oteacgaedcimbs-notshufbsa-i
 
* molecular-weight:
 
* molecular-weight:
** 777.089
+
** 906.621
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8368]]
+
* [[RXN-2425]]
 +
* [[RXN0-2044]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8367]]
+
* [[RXN-2425]]
 +
* [[RXN0-2044]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-18:2-2-18:3-monogalactosyldiacylglycerol}}
+
{{#set: common-name=(3s)-hydroxyadipyl-coa}}
{{#set: inchi-key=inchikey=drlqfbrxasrgdp-bubqrnscsa-n}}
+
{{#set: inchi-key=inchikey=oteacgaedcimbs-notshufbsa-i}}
{{#set: molecular-weight=777.089}}
+
{{#set: molecular-weight=906.621}}

Latest revision as of 11:16, 18 March 2021

Metabolite 3-HYDROXYADIPYL-COA

  • common-name:
    • (3s)-hydroxyadipyl-coa
  • smiles:
    • cc(c)(c(o)c(=o)nccc(=o)nccsc(cc(ccc(=o)[o-])o)=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • oteacgaedcimbs-notshufbsa-i
  • molecular-weight:
    • 906.621

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality