Difference between revisions of "3-HYDROXYADIPYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14125 RXN-14125] == * direction: ** left-to-right * ec-number: ** [http://enzyme.expasy.org/EC/...")
 
(Created page with "Category:metabolite == Metabolite 3-HYDROXYADIPYL-COA == * common-name: ** (3s)-hydroxyadipyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(cc(ccc(=o)[o-])o)=o)cop(=o)(op(...")
 
(9 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14125 RXN-14125] ==
+
== Metabolite 3-HYDROXYADIPYL-COA ==
* direction:
+
* common-name:
** left-to-right
+
** (3s)-hydroxyadipyl-coa
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/4.2.3 ec-4.2.3]
+
** cc(c)(c(o)c(=o)nccc(=o)nccsc(cc(ccc(=o)[o-])o)=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
== Reaction formula ==
+
* inchi-key:
* 1 [[4-PHOSPHONOOXY-THREONINE]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[CPD0-2189]][c] '''+''' 1 [[Pi]][c]
+
** oteacgaedcimbs-notshufbsa-i
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
* Gene: [[SJ11569]]
+
** 906.621
** Category: [[orthology]]
+
== Reaction(s) known to consume the compound ==
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[RXN-2425]]
== Pathway(s) ==
+
* [[RXN0-2044]]
== Reconstruction information  ==
+
== Reaction(s) known to produce the compound ==
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
* [[RXN-2425]]
== External links  ==
+
* [[RXN0-2044]]
* RHEA:
+
== Reaction(s) of unknown directionality ==
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=30662 30662]
+
{{#set: common-name=(3s)-hydroxyadipyl-coa}}
* LIGAND-RXN:
+
{{#set: inchi-key=inchikey=oteacgaedcimbs-notshufbsa-i}}
** [http://www.genome.jp/dbget-bin/www_bget?R05086 R05086]
+
{{#set: molecular-weight=906.621}}
{{#set: direction=left-to-right}}
 
{{#set: ec-number=ec-4.2.3}}
 
{{#set: nb gene associated=1}}
 
{{#set: nb pathway associated=0}}
 
{{#set: reconstruction category=orthology}}
 
{{#set: reconstruction tool=pantograph}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite 3-HYDROXYADIPYL-COA

  • common-name:
    • (3s)-hydroxyadipyl-coa
  • smiles:
    • cc(c)(c(o)c(=o)nccc(=o)nccsc(cc(ccc(=o)[o-])o)=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • oteacgaedcimbs-notshufbsa-i
  • molecular-weight:
    • 906.621

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality