Difference between revisions of "3-Hydroxy-octanoyl-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite UDP-ACETYL-CARBOXYVINYL-GLUCOSAMINE == * common-name: ** udp-n-acetyl-α-d-glucosamine-enolpyruvate * smiles: ** c=c(oc3(c(o)c(co)oc...")
(Created page with "Category:metabolite == Metabolite 3-Hydroxy-octanoyl-ACPs == * common-name: ** a (3r)-3-hydroxyoctanoyl-[acp] == Reaction(s) known to consume the compound == * 4.2.1.59-...")
 
(4 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite UDP-ACETYL-CARBOXYVINYL-GLUCOSAMINE ==
+
== Metabolite 3-Hydroxy-octanoyl-ACPs ==
 
* common-name:
 
* common-name:
** udp-n-acetyl-α-d-glucosamine-enolpyruvate
+
** a (3r)-3-hydroxyoctanoyl-[acp]
* smiles:
 
** c=c(oc3(c(o)c(co)oc(op(=o)([o-])op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))c(nc(c)=o)3))c(=o)[o-]
 
* inchi-key:
 
** begzzypuncjhkp-dbywsuqtsa-k
 
* molecular-weight:
 
** 674.382
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[UDPNACETYLMURAMATEDEHYDROG-RXN]]
+
* [[4.2.1.59-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-9524]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=udp-n-acetyl-α-d-glucosamine-enolpyruvate}}
+
{{#set: common-name=a (3r)-3-hydroxyoctanoyl-[acp]}}
{{#set: inchi-key=inchikey=begzzypuncjhkp-dbywsuqtsa-k}}
 
{{#set: molecular-weight=674.382}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite 3-Hydroxy-octanoyl-ACPs

  • common-name:
    • a (3r)-3-hydroxyoctanoyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a (3r)-3-hydroxyoctanoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.