Difference between revisions of "3-INDOLYLGLYCOLALDEHYDE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ06337 == * transcription-direction: ** positive * right-end-position: ** 170322 * left-end-position: ** 156756 * centisome-position: ** 32.728138...")
(Created page with "Category:metabolite == Metabolite 3-INDOLYLGLYCOLALDEHYDE == * common-name: ** indole-3-glycol aldehyde * smiles: ** c2(=c(c1(c=cc=cc=1n2))c(o)c=o) * inchi-key: ** xkzdnwm...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ06337 ==
+
== Metabolite 3-INDOLYLGLYCOLALDEHYDE ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** indole-3-glycol aldehyde
−
* right-end-position:
+
* smiles:
−
** 170322
+
** c2(=c(c1(c=cc=cc=1n2))c(o)c=o)
−
* left-end-position:
+
* inchi-key:
−
** 156756
+
** xkzdnwmdlgqxml-uhfffaoysa-n
−
* centisome-position:
+
* molecular-weight:
−
** 32.728138   
+
** 175.187
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-5424]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
* [[RXN-11361]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=indole-3-glycol aldehyde}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=xkzdnwmdlgqxml-uhfffaoysa-n}}
−
** Category: [[orthology]]
+
{{#set: molecular-weight=175.187}}
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[RXN-12473]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[RXN0-6359]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[THIOSULFATE-SULFURTRANSFERASE-RXN]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PWY-6823]]
 
−
** '''7''' reactions found over '''8''' reactions in the full pathway
 
−
* [[PWY-5350]]
 
−
** '''1''' reactions found over '''1''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=170322}}
 
−
{{#set: left-end-position=156756}}
 
−
{{#set: centisome-position=32.728138    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=4}}
 
−
{{#set: nb pathway associated=2}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite 3-INDOLYLGLYCOLALDEHYDE

  • common-name:
    • indole-3-glycol aldehyde
  • smiles:
    • c2(=c(c1(c=cc=cc=1n2))c(o)c=o)
  • inchi-key:
    • xkzdnwmdlgqxml-uhfffaoysa-n
  • molecular-weight:
    • 175.187

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=3-INDOLYLGLYCOLALDEHYDE&oldid=136914"