Difference between revisions of "3-KETO-ADIPYL-COA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7033 == * common-name: ** 2-methylbutanol * smiles: ** ccc(co)c * inchi-key: ** qprqedxdyozyla-uhfffaoysa-n * molecular-weight: ** 88...") |
(Created page with "Category:metabolite == Metabolite 3-KETO-ADIPYL-COA == * common-name: ** 3-oxoadipyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(cc(ccc([o-])=o)=o)=o)cop(=o)(op(=o)(occ1...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite 3-KETO-ADIPYL-COA == |
* common-name: | * common-name: | ||
− | ** | + | ** 3-oxoadipyl-coa |
* smiles: | * smiles: | ||
− | ** ccc( | + | ** cc(c)(c(o)c(=o)nccc(=o)nccsc(cc(ccc([o-])=o)=o)=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** vkkkaapgxhwxoo-biewrjsysa-i |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 904.605 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN0-2044]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN0-2044]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=3-oxoadipyl-coa}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=vkkkaapgxhwxoo-biewrjsysa-i}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=904.605}} |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite 3-KETO-ADIPYL-COA
- common-name:
- 3-oxoadipyl-coa
- smiles:
- cc(c)(c(o)c(=o)nccc(=o)nccsc(cc(ccc([o-])=o)=o)=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- vkkkaapgxhwxoo-biewrjsysa-i
- molecular-weight:
- 904.605