Difference between revisions of "3-KETO-ADIPYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7033 == * common-name: ** 2-methylbutanol * smiles: ** ccc(co)c * inchi-key: ** qprqedxdyozyla-uhfffaoysa-n * molecular-weight: ** 88...")
(Created page with "Category:metabolite == Metabolite 3-KETO-ADIPYL-COA == * common-name: ** 3-oxoadipyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(cc(ccc([o-])=o)=o)=o)cop(=o)(op(=o)(occ1...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-7033 ==
+
== Metabolite 3-KETO-ADIPYL-COA ==
 
* common-name:
 
* common-name:
** 2-methylbutanol
+
** 3-oxoadipyl-coa
 
* smiles:
 
* smiles:
** ccc(co)c
+
** cc(c)(c(o)c(=o)nccc(=o)nccsc(cc(ccc([o-])=o)=o)=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** qprqedxdyozyla-uhfffaoysa-n
+
** vkkkaapgxhwxoo-biewrjsysa-i
 
* molecular-weight:
 
* molecular-weight:
** 88.149
+
** 904.605
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN0-2044]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-7694]]
+
* [[RXN0-2044]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-methylbutanol}}
+
{{#set: common-name=3-oxoadipyl-coa}}
{{#set: inchi-key=inchikey=qprqedxdyozyla-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=vkkkaapgxhwxoo-biewrjsysa-i}}
{{#set: molecular-weight=88.149}}
+
{{#set: molecular-weight=904.605}}

Latest revision as of 11:13, 18 March 2021

Metabolite 3-KETO-ADIPYL-COA

  • common-name:
    • 3-oxoadipyl-coa
  • smiles:
    • cc(c)(c(o)c(=o)nccc(=o)nccsc(cc(ccc([o-])=o)=o)=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • vkkkaapgxhwxoo-biewrjsysa-i
  • molecular-weight:
    • 904.605

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality