Difference between revisions of "3-KETO-ADIPYL-COA"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ21571 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * PItm ** Category: or...") |
(Created page with "Category:metabolite == Metabolite 3-KETO-ADIPYL-COA == * common-name: ** 3-oxoadipyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(cc(ccc([o-])=o)=o)=o)cop(=o)(op(=o)(occ1...") |
||
(8 intermediate revisions by 4 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite 3-KETO-ADIPYL-COA == |
− | + | * common-name: | |
− | * | + | ** 3-oxoadipyl-coa |
− | + | * smiles: | |
− | * | + | ** cc(c)(c(o)c(=o)nccc(=o)nccsc(cc(ccc([o-])=o)=o)=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] |
− | * | + | * inchi-key: |
− | * | + | ** vkkkaapgxhwxoo-biewrjsysa-i |
− | * | + | * molecular-weight: |
− | * | + | ** 904.605 |
− | + | == Reaction(s) known to consume the compound == | |
− | + | * [[RXN0-2044]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN0-2044]] | |
− | * | + | == Reaction(s) of unknown directionality == |
− | ** | + | {{#set: common-name=3-oxoadipyl-coa}} |
− | * | + | {{#set: inchi-key=inchikey=vkkkaapgxhwxoo-biewrjsysa-i}} |
− | + | {{#set: molecular-weight=904.605}} | |
− | ** | ||
− | |||
− | * [[ | ||
− | * | ||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite 3-KETO-ADIPYL-COA
- common-name:
- 3-oxoadipyl-coa
- smiles:
- cc(c)(c(o)c(=o)nccc(=o)nccsc(cc(ccc([o-])=o)=o)=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- vkkkaapgxhwxoo-biewrjsysa-i
- molecular-weight:
- 904.605