Difference between revisions of "3-KETO-ADIPYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9646 == * common-name: ** di-trans,octa-cis-undecaprenyl phosphate * smiles: ** cc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(...")
(Created page with "Category:metabolite == Metabolite Lipoprotein-signal-peptide == * common-name: ** a lipoprotein signal peptide == Reaction(s) known to consume the compound == * RXN0-320...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-9646 ==
+
== Metabolite Lipoprotein-signal-peptide ==
 
* common-name:
 
* common-name:
** di-trans,octa-cis-undecaprenyl phosphate
+
** a lipoprotein signal peptide
* smiles:
 
** cc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])[o-])c)c)c
 
* inchi-key:
 
** ufphfkctoziafy-ntdveaecsa-l
 
* molecular-weight:
 
** 845.279
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[PHOSNACMURPENTATRANS-RXN]]
+
* [[RXN0-3201]]
* [[RXN-11347]]
 
* [[RXN-8975]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8975]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=di-trans,octa-cis-undecaprenyl phosphate}}
+
{{#set: common-name=a lipoprotein signal peptide}}
{{#set: inchi-key=inchikey=ufphfkctoziafy-ntdveaecsa-l}}
 
{{#set: molecular-weight=845.279}}
 

Revision as of 18:54, 14 January 2021

Metabolite Lipoprotein-signal-peptide

  • common-name:
    • a lipoprotein signal peptide

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality