Difference between revisions of "3-KETOBUTYRATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite OCTAPRENYL-METHYL-OH-METHOXY-BENZQ == * common-name: ** 3-demethylubiquinol-8 * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=...")
(Created page with "Category:metabolite == Metabolite 3-KETOBUTYRATE == * common-name: ** acetoacetate * smiles: ** cc(=o)cc([o-])=o * inchi-key: ** wdjhalxbufzdsr-uhfffaoysa-m * molecular-we...")
 
(5 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite OCTAPRENYL-METHYL-OH-METHOXY-BENZQ ==
+
== Metabolite 3-KETOBUTYRATE ==
 
* common-name:
 
* common-name:
** 3-demethylubiquinol-8
+
** acetoacetate
 
* smiles:
 
* smiles:
** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(=c(o)c(oc)=c(o)c(o)=c(c)1)
+
** cc(=o)cc([o-])=o
 
* inchi-key:
 
* inchi-key:
** qurlimhpcrkmjp-wdxiliiosa-n
+
** wdjhalxbufzdsr-uhfffaoysa-m
 
* molecular-weight:
 
* molecular-weight:
** 715.11
+
** 101.082
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[DHHB-METHYLTRANSFER-RXN]]
+
* [[3-HYDROXYBUTYRATE-DEHYDROGENASE-RXN]]
 +
* [[ACETOACETATE--COA-LIGASE-RXN]]
 +
* [[HBNOm]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[3-HYDROXYBUTYRATE-DEHYDROGENASE-RXN]]
 +
* [[HBNOm]]
 +
* [[HYDROXYMETHYLGLUTARYL-COA-LYASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-demethylubiquinol-8}}
+
{{#set: common-name=acetoacetate}}
{{#set: inchi-key=inchikey=qurlimhpcrkmjp-wdxiliiosa-n}}
+
{{#set: inchi-key=inchikey=wdjhalxbufzdsr-uhfffaoysa-m}}
{{#set: molecular-weight=715.11}}
+
{{#set: molecular-weight=101.082}}

Latest revision as of 11:17, 18 March 2021

Metabolite 3-KETOBUTYRATE

  • common-name:
    • acetoacetate
  • smiles:
    • cc(=o)cc([o-])=o
  • inchi-key:
    • wdjhalxbufzdsr-uhfffaoysa-m
  • molecular-weight:
    • 101.082

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality