Difference between revisions of "3-Ketopimeloyl-ACP-methyl-esters"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7214 == * common-name: ** (2s)-dihydrotricetin * smiles: ** c3(c(c2(oc1(c=c(c=c(c=1c(c2)=o)o)[o-])))=cc(=c(c=3o)o)o) * inchi-key: **...") |
(Created page with "Category:metabolite == Metabolite N-acetyl-beta-D-hexosamines == * common-name: ** an n-acetyl-β-d-hexosamine == Reaction(s) known to consume the compound == == React...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite N-acetyl-beta-D-hexosamines == |
* common-name: | * common-name: | ||
| − | ** | + | ** an n-acetyl-β-d-hexosamine |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[3.2.1.52-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=an n-acetyl-β-d-hexosamine}} |
| − | |||
| − | |||
Revision as of 08:27, 15 March 2021
Contents
Metabolite N-acetyl-beta-D-hexosamines
- common-name:
- an n-acetyl-β-d-hexosamine
