Difference between revisions of "3-Ketopimeloyl-ACP-methyl-esters"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite C5 == * common-name: ** undecaprenyldiphospho-n-acetylmuramoyl-l-alanyl-γ-d-glutamyl-meso-2,6-diaminopimeloyl-d-alanyl-d-alanine *...")
(Created page with "Category:metabolite == Metabolite 3-Ketopimeloyl-ACP-methyl-esters == * common-name: ** a 3-oxo-pimeloyl-[acp] methyl ester == Reaction(s) known to consume the compound ==...")
 
(5 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite C5 ==
+
== Metabolite 3-Ketopimeloyl-ACP-methyl-esters ==
 
* common-name:
 
* common-name:
−
** undecaprenyldiphospho-n-acetylmuramoyl-l-alanyl-γ-d-glutamyl-meso-2,6-diaminopimeloyl-d-alanyl-d-alanine
+
** a 3-oxo-pimeloyl-[acp] methyl ester
−
* smiles:
 
−
** cc(c)=cccc(c)=cccc(c)=cccc(=cccc(=cccc(=cccc(c)=cccc(=cccc(=cccc(=cccc(=ccop(op([o-])(=o)oc1(c(nc(=o)c)c(oc(c)c(=o)nc(c)c(=o)nc(c(=o)[o-])ccc(=o)nc(cccc([n+])c(=o)[o-])c(nc(c)c(=o)nc(c)c([o-])=o)=o)c(o)c(co)o1))([o-])=o)c)c)c)c)c)c)c
 
−
* inchi-key:
 
−
** pnwzqtonlrrpst-kldrqjoasa-j
 
−
* molecular-weight:
 
−
** 1713.036
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-11480]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[PHOSNACMURPENTATRANS-RXN]]
+
* [[RXN-11479]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=undecaprenyldiphospho-n-acetylmuramoyl-l-alanyl-γ-d-glutamyl-meso-2,6-diaminopimeloyl-d-alanyl-d-alanine}}
+
{{#set: common-name=a 3-oxo-pimeloyl-[acp] methyl ester}}
−
{{#set: inchi-key=inchikey=pnwzqtonlrrpst-kldrqjoasa-j}}
 
−
{{#set: molecular-weight=1713.036}}
 

Latest revision as of 11:14, 18 March 2021

Metabolite 3-Ketopimeloyl-ACP-methyl-esters

  • common-name:
    • a 3-oxo-pimeloyl-[acp] methyl ester

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a 3-oxo-pimeloyl-[acp] methyl ester" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=3-Ketopimeloyl-ACP-methyl-esters&oldid=138201"