Difference between revisions of "3-Ketopimeloyl-ACP-methyl-esters"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15836 == * common-name: ** α-tocotrienol * smiles: ** cc(=cccc(=cccc(=cccc1(c)(oc2(c(cc1)=c(c(=c(c=2c)c)o)c)))c)c)c * inchi-key...") |
(Created page with "Category:metabolite == Metabolite 3-Ketopimeloyl-ACP-methyl-esters == * common-name: ** a 3-oxo-pimeloyl-[acp] methyl ester == Reaction(s) known to consume the compound ==...") |
||
| (4 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 3-Ketopimeloyl-ACP-methyl-esters == |
* common-name: | * common-name: | ||
| − | ** | + | ** a 3-oxo-pimeloyl-[acp] methyl ester |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-11480]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-11479]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a 3-oxo-pimeloyl-[acp] methyl ester}} |
| − | |||
| − | |||
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite 3-Ketopimeloyl-ACP-methyl-esters
- common-name:
- a 3-oxo-pimeloyl-[acp] methyl ester
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a 3-oxo-pimeloyl-[acp] methyl ester" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
