Difference between revisions of "3-MERCAPTO-PYRUVATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite TRP-tRNAs == * common-name: ** a trnatrp == Reaction(s) known to consume the compound == * TRYPTOPHAN--TRNA-LIGASE-RXN == Reaction(s)...") |
(Created page with "Category:metabolite == Metabolite CARNOSINE == * common-name: ** carnosine * smiles: ** c(cc(=o)nc(cc1(=cnc=n1))c([o-])=o)[n+] * inchi-key: ** cqovpnpjlqnmdc-zetcqymhsa-n...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CARNOSINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** carnosine |
| + | * smiles: | ||
| + | ** c(cc(=o)nc(cc1(=cnc=n1))c([o-])=o)[n+] | ||
| + | * inchi-key: | ||
| + | ** cqovpnpjlqnmdc-zetcqymhsa-n | ||
| + | * molecular-weight: | ||
| + | ** 226.235 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[CARNOSINE-N-METHYLTRANSFERASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=carnosine}} |
| + | {{#set: inchi-key=inchikey=cqovpnpjlqnmdc-zetcqymhsa-n}} | ||
| + | {{#set: molecular-weight=226.235}} | ||
Revision as of 08:30, 15 March 2021
Contents
Metabolite CARNOSINE
- common-name:
- carnosine
- smiles:
- c(cc(=o)nc(cc1(=cnc=n1))c([o-])=o)[n+]
- inchi-key:
- cqovpnpjlqnmdc-zetcqymhsa-n
- molecular-weight:
- 226.235
