Difference between revisions of "3-METHYL-1-246-TRIHYDROXYPHENYLBUTAN"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ00718 == * transcription-direction: ** negative * right-end-position: ** 340652 * left-end-position: ** 334572 * centisome-position: ** 59.26002...")
(Created page with "Category:metabolite == Metabolite TYR == * common-name: ** l-tyrosine * smiles: ** c(c(cc1(c=cc(o)=cc=1))[n+])(=o)[o-] * inchi-key: ** ouycccasqsfeme-qmmmgpobsa-n * molecu...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ00718 ==
+
== Metabolite TYR ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** l-tyrosine
−
* right-end-position:
+
* smiles:
−
** 340652
+
** c(c(cc1(c=cc(o)=cc=1))[n+])(=o)[o-]
−
* left-end-position:
+
* inchi-key:
−
** 334572
+
** ouycccasqsfeme-qmmmgpobsa-n
−
* centisome-position:
+
* molecular-weight:
−
** 59.26002   
+
** 181.191
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[6.3.2.25-RXN]]
−
== Reaction(s) associated ==
+
* [[MONOPHENOL-MONOOXYGENASE-RXN]]
−
* [[SERINE-O-ACETTRAN-RXN]]
+
* [[RXN-11319]]
−
** Category: [[annotation]]
+
* [[RXN-5861]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[TYROSINE--TRNA-LIGASE-RXN]]
−
** Category: [[orthology]]
+
* [[TYROSINE-AMINOTRANSFERASE-RXN]]
−
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
+
* [[TYROSINE-DECARBOXYLASE-RXN]]
−
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
+
* [[biomass_rxn]]
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
== Reaction(s) known to produce the compound ==
−
== Pathway(s) associated ==
+
* [[RXN-5682]]
−
* [[PWY-7870]]
+
* [[TYROSINE-AMINOTRANSFERASE-RXN]]
−
** '''2''' reactions found over '''4''' reactions in the full pathway
+
== Reaction(s) of unknown directionality ==
−
* [[PWY-7274]]
+
{{#set: common-name=l-tyrosine}}
−
** '''1''' reactions found over '''6''' reactions in the full pathway
+
{{#set: inchi-key=inchikey=ouycccasqsfeme-qmmmgpobsa-n}}
−
* [[CYSTSYN-PWY]]
+
{{#set: molecular-weight=181.191}}
−
** '''2''' reactions found over '''2''' reactions in the full pathway
 
−
* [[PWY-6936]]
 
−
** '''5''' reactions found over '''5''' reactions in the full pathway
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=340652}}
 
−
{{#set: left-end-position=334572}}
 
−
{{#set: centisome-position=59.26002    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=1}}
 
−
{{#set: nb pathway associated=4}}
 

Revision as of 20:29, 18 December 2020

Metabolite TYR

  • common-name:
    • l-tyrosine
  • smiles:
    • c(c(cc1(c=cc(o)=cc=1))[n+])(=o)[o-]
  • inchi-key:
    • ouycccasqsfeme-qmmmgpobsa-n
  • molecular-weight:
    • 181.191

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=3-METHYL-1-246-TRIHYDROXYPHENYLBUTAN&oldid=45469"