Difference between revisions of "3-METHYL-1-246-TRIHYDROXYPHENYLBUTAN"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite TYR == * common-name: ** l-tyrosine * smiles: ** c(c(cc1(c=cc(o)=cc=1))[n+])(=o)[o-] * inchi-key: ** ouycccasqsfeme-qmmmgpobsa-n * molecu...") |
(Created page with "Category:metabolite == Metabolite CPD-597 == * common-name: ** n-carbamoylputrescine * smiles: ** c(cccnc(n)=o)[n+] * inchi-key: ** yanfyyganiyhgi-uhfffaoysa-o * molecular...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-597 == |
* common-name: | * common-name: | ||
| − | ** | + | ** n-carbamoylputrescine |
* smiles: | * smiles: | ||
| − | ** c( | + | ** c(cccnc(n)=o)[n+] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** yanfyyganiyhgi-uhfffaoysa-o |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 132.185 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[N-CARBAMOYLPUTRESCINE-AMIDASE-RXN]] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[AGMATINE-DEIMINASE-RXN]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=n-carbamoylputrescine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=yanfyyganiyhgi-uhfffaoysa-o}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=132.185}} |
Revision as of 14:53, 5 January 2021
Contents
Metabolite CPD-597
- common-name:
- n-carbamoylputrescine
- smiles:
- c(cccnc(n)=o)[n+]
- inchi-key:
- yanfyyganiyhgi-uhfffaoysa-o
- molecular-weight:
- 132.185
