Difference between revisions of "3-METHYL-CROTONYL-COA"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ07491 == * transcription-direction: ** positive * right-end-position: ** 242058 * left-end-position: ** 220161 * centisome-position: ** 48.37183...") |
(Created page with "Category:metabolite == Metabolite 3-METHYL-CROTONYL-COA == * common-name: ** 3-methylcrotonyl-coa * smiles: ** cc(=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(...") |
||
(7 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite 3-METHYL-CROTONYL-COA == |
− | * | + | * common-name: |
− | ** | + | ** 3-methylcrotonyl-coa |
− | + | * smiles: | |
− | + | ** cc(=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])c | |
− | * | + | * inchi-key: |
− | ** | + | ** bxipalatiynhjn-zmhdxicwsa-j |
− | + | * molecular-weight: | |
− | + | ** 845.604 | |
− | == | + | == Reaction(s) known to consume the compound == |
− | + | * [[ECH_LPAREN_3hivcoa_RPAREN_]] | |
− | = | + | * [[METHYLCROTONYL-COA-CARBOXYLASE-RXN]] |
− | + | * [[RXN-14264]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[ECH_LPAREN_3hivcoa_RPAREN_]] | |
− | * | + | * [[IVCDH]] |
− | ** | + | * [[RXN-11921]] |
− | * | + | * [[RXN-14264]] |
− | ** | + | * [[RXN0-2301]] |
− | + | == Reaction(s) of unknown directionality == | |
− | * | + | {{#set: common-name=3-methylcrotonyl-coa}} |
− | * | + | {{#set: inchi-key=inchikey=bxipalatiynhjn-zmhdxicwsa-j}} |
− | + | {{#set: molecular-weight=845.604}} | |
− | |||
− | |||
− | * [[RXN- | ||
− | * | ||
− | * | ||
− | * [[RXN- | ||
− | * | ||
− | |||
− | * [[RXN0- | ||
− | |||
− | |||
− | |||
− | == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite 3-METHYL-CROTONYL-COA
- common-name:
- 3-methylcrotonyl-coa
- smiles:
- cc(=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])c
- inchi-key:
- bxipalatiynhjn-zmhdxicwsa-j
- molecular-weight:
- 845.604