Difference between revisions of "3-METHYL-CROTONYL-COA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Palmitoyl-proteins == * common-name: ** a palmitoylated protein == Reaction(s) known to consume the compound == * 3.1.2.22-RXN == Rea...") |
(Created page with "Category:metabolite == Metabolite 3-METHYL-CROTONYL-COA == * common-name: ** 3-methylcrotonyl-coa * smiles: ** cc(=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(...") |
||
| (3 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 3-METHYL-CROTONYL-COA == |
* common-name: | * common-name: | ||
| − | ** | + | ** 3-methylcrotonyl-coa |
| + | * smiles: | ||
| + | ** cc(=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])c | ||
| + | * inchi-key: | ||
| + | ** bxipalatiynhjn-zmhdxicwsa-j | ||
| + | * molecular-weight: | ||
| + | ** 845.604 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[ECH_LPAREN_3hivcoa_RPAREN_]] |
| + | * [[METHYLCROTONYL-COA-CARBOXYLASE-RXN]] | ||
| + | * [[RXN-14264]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[ECH_LPAREN_3hivcoa_RPAREN_]] | ||
| + | * [[IVCDH]] | ||
| + | * [[RXN-11921]] | ||
| + | * [[RXN-14264]] | ||
| + | * [[RXN0-2301]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3-methylcrotonyl-coa}} |
| + | {{#set: inchi-key=inchikey=bxipalatiynhjn-zmhdxicwsa-j}} | ||
| + | {{#set: molecular-weight=845.604}} | ||
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite 3-METHYL-CROTONYL-COA
- common-name:
- 3-methylcrotonyl-coa
- smiles:
- cc(=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])c
- inchi-key:
- bxipalatiynhjn-zmhdxicwsa-j
- molecular-weight:
- 845.604
