Difference between revisions of "3-METHYL-CROTONYL-COA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-474 == * common-name: ** (+)-taxifolin * smiles: ** c1(c=c(o)c(o)=cc=1c2(oc3(c=c([o-])c=c(o)c(c(=o)c(o)2)=3))) * inchi-key: ** cxqwrc...") |
(Created page with "Category:metabolite == Metabolite TusE-S-sulfanylcysteine == * common-name: ** a [tuse sulfur carrier protein]-s-sulfanylcysteine == Reaction(s) known to consume the compo...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite TusE-S-sulfanylcysteine == |
* common-name: | * common-name: | ||
− | ** | + | ** a [tuse sulfur carrier protein]-s-sulfanylcysteine |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN0-2023]] |
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a [tuse sulfur carrier protein]-s-sulfanylcysteine}} |
− | |||
− |
Revision as of 14:56, 5 January 2021
Contents
Metabolite TusE-S-sulfanylcysteine
- common-name:
- a [tuse sulfur carrier protein]-s-sulfanylcysteine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a [tuse sulfur carrier protein]-s-sulfanylcysteine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.