Difference between revisions of "3-METHYL-CROTONYL-COA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite TusE-S-sulfanylcysteine == * common-name: ** a [tuse sulfur carrier protein]-s-sulfanylcysteine == Reaction(s) known to consume the compo...") |
(Created page with "Category:metabolite == Metabolite CPD-237 == * common-name: ** (indol-3-yl)acetamide * smiles: ** c(n)(=o)cc1(=cnc2(c=cc=cc1=2)) * inchi-key: ** zoambxdogprzlp-uhfffaoysa-...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-237 == |
* common-name: | * common-name: | ||
| − | ** | + | ** (indol-3-yl)acetamide |
| + | * smiles: | ||
| + | ** c(n)(=o)cc1(=cnc2(c=cc=cc1=2)) | ||
| + | * inchi-key: | ||
| + | ** zoambxdogprzlp-uhfffaoysa-n | ||
| + | * molecular-weight: | ||
| + | ** 174.202 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXNN-404]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[TRYPTOPHAN-2-MONOOXYGENASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(indol-3-yl)acetamide}} |
| + | {{#set: inchi-key=inchikey=zoambxdogprzlp-uhfffaoysa-n}} | ||
| + | {{#set: molecular-weight=174.202}} | ||
Revision as of 15:27, 5 January 2021
Contents
Metabolite CPD-237
- common-name:
- (indol-3-yl)acetamide
- smiles:
- c(n)(=o)cc1(=cnc2(c=cc=cc1=2))
- inchi-key:
- zoambxdogprzlp-uhfffaoysa-n
- molecular-weight:
- 174.202
