Difference between revisions of "3-METHYL-CROTONYL-COA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-237 == * common-name: ** (indol-3-yl)acetamide * smiles: ** c(n)(=o)cc1(=cnc2(c=cc=cc1=2)) * inchi-key: ** zoambxdogprzlp-uhfffaoysa-...") |
(Created page with "Category:metabolite == Metabolite Palmitoyl-proteins == * common-name: ** a palmitoylated protein == Reaction(s) known to consume the compound == * 3.1.2.22-RXN == Rea...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Palmitoyl-proteins == |
* common-name: | * common-name: | ||
| − | ** | + | ** a palmitoylated protein |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[3.1.2.22-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a palmitoylated protein}} |
| − | |||
| − | |||
Revision as of 13:10, 14 January 2021
Contents
Metabolite Palmitoyl-proteins
- common-name:
- a palmitoylated protein
