Difference between revisions of "3-Methoxy-4-Hydroxy-5-Polyprenylbenzoate"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite UDP-4-AMINO-4-DEOXY-L-ARABINOSE == * common-name: ** udp-4-amino-4-deoxy-β-l-arabinopyranose * smiles: ** c(op(=o)([o-])op(=o)([o-])...")
(Created page with "Category:metabolite == Metabolite 3-Methoxy-4-Hydroxy-5-Polyprenylbenzoate == * common-name: ** a 3-methoxy-4-hydroxy-5-all-trans-polyprenylbenzoate == Reaction(s) known t...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite UDP-4-AMINO-4-DEOXY-L-ARABINOSE ==
+
== Metabolite 3-Methoxy-4-Hydroxy-5-Polyprenylbenzoate ==
 
* common-name:
 
* common-name:
−
** udp-4-amino-4-deoxy-β-l-arabinopyranose
+
** a 3-methoxy-4-hydroxy-5-all-trans-polyprenylbenzoate
−
* smiles:
 
−
** c(op(=o)([o-])op(=o)([o-])oc1(occ([n+])c(o)c(o)1))c2(oc(c(o)c(o)2)n3(c=cc(=o)nc(=o)3))
 
−
* inchi-key:
 
−
** gwbakybswhqnmq-iazovdbxsa-m
 
−
* molecular-weight:
 
−
** 534.286
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN0-1863]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN0-1863]]
+
* [[RXN-11757]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=udp-4-amino-4-deoxy-β-l-arabinopyranose}}
+
{{#set: common-name=a 3-methoxy-4-hydroxy-5-all-trans-polyprenylbenzoate}}
−
{{#set: inchi-key=inchikey=gwbakybswhqnmq-iazovdbxsa-m}}
 
−
{{#set: molecular-weight=534.286}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite 3-Methoxy-4-Hydroxy-5-Polyprenylbenzoate

  • common-name:
    • a 3-methoxy-4-hydroxy-5-all-trans-polyprenylbenzoate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=3-Methoxy-4-Hydroxy-5-Polyprenylbenzoate&oldid=137901"