Difference between revisions of "3-Methoxy-4-Hydroxy-5-Polyprenylbenzoate"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ04934 == * transcription-direction: ** positive * right-end-position: ** 69054 * left-end-position: ** 62180 * centisome-position: ** 63.459988...")
(Created page with "Category:metabolite == Metabolite CPD-13014 == * common-name: ** tributyrin * smiles: ** cccc(occ(oc(ccc)=o)coc(ccc)=o)=o * inchi-key: ** uyxtwwcetriedr-uhfffaoysa-n * mol...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ04934 ==
+
== Metabolite CPD-13014 ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** tributyrin
−
* right-end-position:
+
* smiles:
−
** 69054
+
** cccc(occ(oc(ccc)=o)coc(ccc)=o)=o
−
* left-end-position:
+
* inchi-key:
−
** 62180
+
** uyxtwwcetriedr-uhfffaoysa-n
−
* centisome-position:
+
* molecular-weight:
−
** 63.459988   
+
** 302.367
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-12086]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
== Reaction(s) of unknown directionality ==
−
* [[3.6.1.52-RXN]]
+
{{#set: common-name=tributyrin}}
−
** Category: [[annotation]]
+
{{#set: inchi-key=inchikey=uyxtwwcetriedr-uhfffaoysa-n}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: molecular-weight=302.367}}
−
* [[DCTP-PYROPHOSPHATASE-RXN]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[DUTP-PYROP-RXN]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[NUCLEOTIDE-PYROPHOSPHATASE-RXN]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-10963]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-10964]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-10965]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-10975]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-10976]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-10977]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-10978]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-14139]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-14140]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN0-383]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN0-384]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN0-385]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN0-5107]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN0-6382]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
</div>
 
−
== Pathway(s) associated ==
 
−
* [[PWY-7206]]
 
−
** '''2''' reactions found over '''3''' reactions in the full pathway
 
−
* [[PWY-7187]]
 
−
** '''6''' reactions found over '''7''' reactions in the full pathway
 
−
* [[PWY0-166]]
 
−
** '''14''' reactions found over '''13''' reactions in the full pathway
 
−
* [[PWY-7184]]
 
−
** '''9''' reactions found over '''9''' reactions in the full pathway
 
−
* [[PWY-6545]]
 
−
** '''8''' reactions found over '''9''' reactions in the full pathway
 
−
* [[PWY-7821]]
 
−
** '''2''' reactions found over '''9''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=69054}}
 
−
{{#set: left-end-position=62180}}
 
−
{{#set: centisome-position=63.459988    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=18}}
 
−
{{#set: nb pathway associated=6}}
 

Revision as of 20:33, 18 December 2020

Metabolite CPD-13014

  • common-name:
    • tributyrin
  • smiles:
    • cccc(occ(oc(ccc)=o)coc(ccc)=o)=o
  • inchi-key:
    • uyxtwwcetriedr-uhfffaoysa-n
  • molecular-weight:
    • 302.367

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=3-Methoxy-4-Hydroxy-5-Polyprenylbenzoate&oldid=46717"