Difference between revisions of "3-Methyl-Saturated-Fatty-Acyl-CoA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-3569 == * common-name: ** glycyl-l-glutamate * smiles: ** c([n+])c(=o)nc(ccc(=o)[o-])c([o-])=o * inchi-key: ** iefjwdngdzaynz-bypyzuc...") |
(Created page with "Category:metabolite == Metabolite Dipeptides-With-Proline-Carboxy == * common-name: ** a dipeptide with proline at the c-terminal == Reaction(s) known to consume the compo...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite Dipeptides-With-Proline-Carboxy == |
* common-name: | * common-name: | ||
− | ** | + | ** a dipeptide with proline at the c-terminal |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[3.4.13.9-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a dipeptide with proline at the c-terminal}} |
− | |||
− |
Revision as of 15:30, 5 January 2021
Contents
Metabolite Dipeptides-With-Proline-Carboxy
- common-name:
- a dipeptide with proline at the c-terminal