Difference between revisions of "3-OCTAPRENYL-4-HYDROXYBENZOATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-22765 == == Reaction(s) known to consume the compound == * RXN21166 == Reaction(s) known to produce the compound == * [[RXN21165]...")
(Created page with "Category:metabolite == Metabolite 3-OCTAPRENYL-4-HYDROXYBENZOATE == * common-name: ** 3-octaprenyl-4-hydroxybenzoate * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=c...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-22765 ==
+
== Metabolite 3-OCTAPRENYL-4-HYDROXYBENZOATE ==
 +
* common-name:
 +
** 3-octaprenyl-4-hydroxybenzoate
 +
* smiles:
 +
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(o)c=cc(c(=o)[o-])=c1))c)c)c)c)c)c)c)c
 +
* inchi-key:
 +
** utibhebnildqkx-lqokpsqisa-m
 +
* molecular-weight:
 +
** 682.06
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN21166]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN21165]]
+
* [[4OHBENZOATE-OCTAPRENYLTRANSFER-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
{{#set: common-name=3-octaprenyl-4-hydroxybenzoate}}
 +
{{#set: inchi-key=inchikey=utibhebnildqkx-lqokpsqisa-m}}
 +
{{#set: molecular-weight=682.06}}

Latest revision as of 11:17, 18 March 2021

Metabolite 3-OCTAPRENYL-4-HYDROXYBENZOATE

  • common-name:
    • 3-octaprenyl-4-hydroxybenzoate
  • smiles:
    • cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(o)c=cc(c(=o)[o-])=c1))c)c)c)c)c)c)c)c
  • inchi-key:
    • utibhebnildqkx-lqokpsqisa-m
  • molecular-weight:
    • 682.06

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality