Difference between revisions of "3-OXOPIMELOYL-COA"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=4.2.1.93-RXN 4.2.1.93-RXN] == * direction: ** left-to-right * common-name: ** atp-dependent nadh-hy...") |
(Created page with "Category:metabolite == Metabolite 3-OXOPIMELOYL-COA == * common-name: ** 3-oxopimeloyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(cc(cccc([o-])=o)=o)=o)cop(=o)(op(=o)(o...") |
||
(8 intermediate revisions by 4 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite 3-OXOPIMELOYL-COA == |
− | |||
− | |||
* common-name: | * common-name: | ||
− | ** | + | ** 3-oxopimeloyl-coa |
− | * | + | * smiles: |
− | ** [ | + | ** cc(c)(c(o)c(=o)nccc(=o)nccsc(cc(cccc([o-])=o)=o)=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] |
− | == | + | * inchi-key: |
− | + | ** kjxfofktzdjlmq-uyrkptjqsa-i | |
− | == | + | * molecular-weight: |
− | + | ** 918.632 | |
− | * | + | == Reaction(s) known to consume the compound == |
− | *** | + | * [[RXN-8032]] |
− | == | + | == Reaction(s) known to produce the compound == |
− | * [[ | + | * [[RXN-8032]] |
− | + | == Reaction(s) of unknown directionality == | |
− | == | + | {{#set: common-name=3-oxopimeloyl-coa}} |
− | * | + | {{#set: inchi-key=inchikey=kjxfofktzdjlmq-uyrkptjqsa-i}} |
− | == | + | {{#set: molecular-weight=918.632}} |
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: common-name= | ||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | |||
− | |||
− | |||
− |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite 3-OXOPIMELOYL-COA
- common-name:
- 3-oxopimeloyl-coa
- smiles:
- cc(c)(c(o)c(=o)nccc(=o)nccsc(cc(cccc([o-])=o)=o)=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- kjxfofktzdjlmq-uyrkptjqsa-i
- molecular-weight:
- 918.632