Difference between revisions of "3-OXOPIMELOYL-COA"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ08230 == * transcription-direction: ** negative * right-end-position: ** 52222 * left-end-position: ** 49666 * centisome-position: ** 88.21356...") |
(Created page with "Category:metabolite == Metabolite 3-OXOPIMELOYL-COA == * common-name: ** 3-oxopimeloyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(cc(cccc([o-])=o)=o)=o)cop(=o)(op(=o)(o...") |
||
| (9 intermediate revisions by 5 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite 3-OXOPIMELOYL-COA == |
| − | * | + | * common-name: |
| − | ** | + | ** 3-oxopimeloyl-coa |
| − | * | + | * smiles: |
| − | ** | + | ** cc(c)(c(o)c(=o)nccc(=o)nccsc(cc(cccc([o-])=o)=o)=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] |
| − | * | + | * inchi-key: |
| − | ** | + | ** kjxfofktzdjlmq-uyrkptjqsa-i |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 918.632 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-8032]] |
| − | == Reaction(s) | + | == Reaction(s) known to produce the compound == |
| − | * [[ | + | * [[RXN-8032]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | {{#set: common-name=3-oxopimeloyl-coa}} | |
| − | == | + | {{#set: inchi-key=inchikey=kjxfofktzdjlmq-uyrkptjqsa-i}} |
| − | + | {{#set: molecular-weight=918.632}} | |
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite 3-OXOPIMELOYL-COA
- common-name:
- 3-oxopimeloyl-coa
- smiles:
- cc(c)(c(o)c(=o)nccc(=o)nccsc(cc(cccc([o-])=o)=o)=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- kjxfofktzdjlmq-uyrkptjqsa-i
- molecular-weight:
- 918.632
