Difference between revisions of "3-Oxo-5-Alpha-Steroids"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11938 == * common-name: ** 1d-myo-inositol 1,5-bis(diphosphate) 2,3,4,6-tetrakisphosphate * smiles: ** c1(op(=o)([o-])[o-])(c(op(=o)(...")
(Created page with "Category:metabolite == Metabolite CPD-18350 == * common-name: ** 1-palmitoyl-2-palmitoleoyl phosphatidate * smiles: ** cccccccccccccccc(occ(oc(=o)cccccccc=ccccccc)cop([o-]...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-11938 ==
+
== Metabolite CPD-18350 ==
 
* common-name:
 
* common-name:
** 1d-myo-inositol 1,5-bis(diphosphate) 2,3,4,6-tetrakisphosphate
+
** 1-palmitoyl-2-palmitoleoyl phosphatidate
 
* smiles:
 
* smiles:
** c1(op(=o)([o-])[o-])(c(op(=o)([o-])[o-])c(op([o-])(=o)op([o-])(=o)[o-])c(op([o-])(=o)[o-])c(op(op([o-])(=o)[o-])([o-])=o)c(op([o-])([o-])=o)1)
+
** cccccccccccccccc(occ(oc(=o)cccccccc=ccccccc)cop([o-])(=o)[o-])=o
 
* inchi-key:
 
* inchi-key:
** hhqooerqsfjgep-slwywoedsa-a
+
** scnlprdasxifjk-iqulndiksa-l
 
* molecular-weight:
 
* molecular-weight:
** 805.885
+
** 644.867
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10965]]
 
* [[RXN-10975]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.7.4.24-RXN]]
+
* [[RXN-17008]]
* [[RXN-10965]]
+
* [[RXN-17012]]
* [[RXN-10974]]
 
* [[RXN-10975]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1d-myo-inositol 1,5-bis(diphosphate) 2,3,4,6-tetrakisphosphate}}
+
{{#set: common-name=1-palmitoyl-2-palmitoleoyl phosphatidate}}
{{#set: inchi-key=inchikey=hhqooerqsfjgep-slwywoedsa-a}}
+
{{#set: inchi-key=inchikey=scnlprdasxifjk-iqulndiksa-l}}
{{#set: molecular-weight=805.885}}
+
{{#set: molecular-weight=644.867}}

Revision as of 14:56, 5 January 2021

Metabolite CPD-18350

  • common-name:
    • 1-palmitoyl-2-palmitoleoyl phosphatidate
  • smiles:
    • cccccccccccccccc(occ(oc(=o)cccccccc=ccccccc)cop([o-])(=o)[o-])=o
  • inchi-key:
    • scnlprdasxifjk-iqulndiksa-l
  • molecular-weight:
    • 644.867

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality