Difference between revisions of "3-Oxo-5-Alpha-Steroids"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-18350 == * common-name: ** 1-palmitoyl-2-palmitoleoyl phosphatidate * smiles: ** cccccccccccccccc(occ(oc(=o)cccccccc=ccccccc)cop([o-]...")
(Created page with "Category:metabolite == Metabolite 3-METHYL-CROTONYL-COA == * common-name: ** 3-methylcrotonyl-coa * smiles: ** cc(=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-18350 ==
+
== Metabolite 3-METHYL-CROTONYL-COA ==
 
* common-name:
 
* common-name:
** 1-palmitoyl-2-palmitoleoyl phosphatidate
+
** 3-methylcrotonyl-coa
 
* smiles:
 
* smiles:
** cccccccccccccccc(occ(oc(=o)cccccccc=ccccccc)cop([o-])(=o)[o-])=o
+
** cc(=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])c
 
* inchi-key:
 
* inchi-key:
** scnlprdasxifjk-iqulndiksa-l
+
** bxipalatiynhjn-zmhdxicwsa-j
 
* molecular-weight:
 
* molecular-weight:
** 644.867
+
** 845.604
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[ECH_LPAREN_3hivcoa_RPAREN_]]
 +
* [[METHYLCROTONYL-COA-CARBOXYLASE-RXN]]
 +
* [[RXN-14264]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17008]]
+
* [[ECH_LPAREN_3hivcoa_RPAREN_]]
* [[RXN-17012]]
+
* [[IVCDH]]
 +
* [[RXN-11921]]
 +
* [[RXN-14264]]
 +
* [[RXN0-2301]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-palmitoyl-2-palmitoleoyl phosphatidate}}
+
{{#set: common-name=3-methylcrotonyl-coa}}
{{#set: inchi-key=inchikey=scnlprdasxifjk-iqulndiksa-l}}
+
{{#set: inchi-key=inchikey=bxipalatiynhjn-zmhdxicwsa-j}}
{{#set: molecular-weight=644.867}}
+
{{#set: molecular-weight=845.604}}

Revision as of 15:27, 5 January 2021

Metabolite 3-METHYL-CROTONYL-COA

  • common-name:
    • 3-methylcrotonyl-coa
  • smiles:
    • cc(=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])c
  • inchi-key:
    • bxipalatiynhjn-zmhdxicwsa-j
  • molecular-weight:
    • 845.604

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality