Difference between revisions of "3-Oxo-Delta-4-Steroids"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 1-O-SINAPOYL-BETA-D-GLUCOSE == * common-name: ** 1-o-sinapoyl-β-d-glucose * smiles: ** coc2(=cc(c=cc(=o)oc1(c(o)c(c(c(o1)co)o)o))=cc...")
(Created page with "Category:metabolite == Metabolite Pyrimidine-Bases == * common-name: ** a pyrimidine base == Reaction(s) known to consume the compound == == Reaction(s) known to produce t...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 1-O-SINAPOYL-BETA-D-GLUCOSE ==
+
== Metabolite Pyrimidine-Bases ==
 
* common-name:
 
* common-name:
** 1-o-sinapoyl-β-d-glucose
+
** a pyrimidine base
* smiles:
 
** coc2(=cc(c=cc(=o)oc1(c(o)c(c(c(o1)co)o)o))=cc(=c(o)2)oc)
 
* inchi-key:
 
** xrkbrpftfkkhef-dgdbgzaxsa-n
 
* molecular-weight:
 
** 386.355
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.3.1.91-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RIBOSYLPYRIMIDINE-NUCLEOSIDASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-o-sinapoyl-β-d-glucose}}
+
{{#set: common-name=a pyrimidine base}}
{{#set: inchi-key=inchikey=xrkbrpftfkkhef-dgdbgzaxsa-n}}
 
{{#set: molecular-weight=386.355}}
 

Revision as of 08:29, 15 March 2021

Metabolite Pyrimidine-Bases

  • common-name:
    • a pyrimidine base

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality