Difference between revisions of "3-Oxo-octanoyl-ACPs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7243 == * common-name: ** (24e)-3α,7α,12α-trihydroxy-5β-cholest-24-enoyl-coa * smiles: ** cc(ccc=c(c)c(sccnc(=...") |
(Created page with "Category:metabolite == Metabolite DI-H-OROTATE == * common-name: ** (s)-dihydroorotate * smiles: ** c1(c(=o)nc(=o)nc(c(=o)[o-])1) * inchi-key: ** ufivepvsagbusi-reohclbhsa...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite DI-H-OROTATE == |
* common-name: | * common-name: | ||
| − | ** ( | + | ** (s)-dihydroorotate |
* smiles: | * smiles: | ||
| − | ** | + | ** c1(c(=o)nc(=o)nc(c(=o)[o-])1) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ufivepvsagbusi-reohclbhsa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 157.105 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[DIHYDROOROT-RXN]] |
| + | * [[DIHYDROOROTATE-DEHYDROGENASE-RXN]] | ||
| + | * [[RXN0-6491]] | ||
| + | * [[RXN0-6554]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[DIHYDROOROT-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=( | + | {{#set: common-name=(s)-dihydroorotate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ufivepvsagbusi-reohclbhsa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=157.105}} |
Revision as of 11:17, 15 January 2021
Contents
Metabolite DI-H-OROTATE
- common-name:
- (s)-dihydroorotate
- smiles:
- c1(c(=o)nc(=o)nc(c(=o)[o-])1)
- inchi-key:
- ufivepvsagbusi-reohclbhsa-m
- molecular-weight:
- 157.105
