Difference between revisions of "3-Oxo-octanoyl-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite DI-H-OROTATE == * common-name: ** (s)-dihydroorotate * smiles: ** c1(c(=o)nc(=o)nc(c(=o)[o-])1) * inchi-key: ** ufivepvsagbusi-reohclbhsa...")
(Created page with "Category:metabolite == Metabolite RNASE-III-PROCESSING-PRODUCT-MRNA == * common-name: ** rnase iii processing product mrna == Reaction(s) known to consume the compound ==...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite DI-H-OROTATE ==
+
== Metabolite RNASE-III-PROCESSING-PRODUCT-MRNA ==
 
* common-name:
 
* common-name:
** (s)-dihydroorotate
+
** rnase iii processing product mrna
* smiles:
 
** c1(c(=o)nc(=o)nc(c(=o)[o-])1)
 
* inchi-key:
 
** ufivepvsagbusi-reohclbhsa-m
 
* molecular-weight:
 
** 157.105
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[DIHYDROOROT-RXN]]
 
* [[DIHYDROOROTATE-DEHYDROGENASE-RXN]]
 
* [[RXN0-6491]]
 
* [[RXN0-6554]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[DIHYDROOROT-RXN]]
+
* [[3.1.26.3-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(s)-dihydroorotate}}
+
{{#set: common-name=rnase iii processing product mrna}}
{{#set: inchi-key=inchikey=ufivepvsagbusi-reohclbhsa-m}}
 
{{#set: molecular-weight=157.105}}
 

Revision as of 08:28, 15 March 2021

Metabolite RNASE-III-PROCESSING-PRODUCT-MRNA

  • common-name:
    • rnase iii processing product mrna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality