Difference between revisions of "3-Oxo-octanoyl-ACPs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DI-H-OROTATE == * common-name: ** (s)-dihydroorotate * smiles: ** c1(c(=o)nc(=o)nc(c(=o)[o-])1) * inchi-key: ** ufivepvsagbusi-reohclbhsa...") |
(Created page with "Category:metabolite == Metabolite 3-Oxo-octanoyl-ACPs == * common-name: ** a 3-oxo-octanoyl-[acp] == Reaction(s) known to consume the compound == * RXN-9524 == Reactio...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 3-Oxo-octanoyl-ACPs == |
* common-name: | * common-name: | ||
| − | ** | + | ** a 3-oxo-octanoyl-[acp] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-9524]] |
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-9523]] |
| + | * [[RXN-9650]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a 3-oxo-octanoyl-[acp]}} |
| − | |||
| − | |||
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite 3-Oxo-octanoyl-ACPs
- common-name:
- a 3-oxo-octanoyl-[acp]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a 3-oxo-octanoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
