Difference between revisions of "3-Oxo-octanoyl-ACPs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite GDP == * common-name: ** gdp * smiles: ** c(op(=o)([o-])op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(n)=nc=23))) * inchi-key: ** qgw...") |
(Created page with "Category:metabolite == Metabolite R-3-hydroxybehenoyl-ACPs == * common-name: ** a (3r)-3-hydroxybehenoyl-[acp] == Reaction(s) known to consume the compound == * RXN1G-36...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite R-3-hydroxybehenoyl-ACPs == |
* common-name: | * common-name: | ||
− | ** | + | ** a (3r)-3-hydroxybehenoyl-[acp] |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN1G-363]] |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | + | * [[RXN1G-157]] | |
− | + | * [[RXN1G-469]] | |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | * [[ | ||
− | * [[ | ||
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a (3r)-3-hydroxybehenoyl-[acp]}} |
− | |||
− |
Revision as of 13:11, 14 January 2021
Contents
Metabolite R-3-hydroxybehenoyl-ACPs
- common-name:
- a (3r)-3-hydroxybehenoyl-[acp]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a (3r)-3-hydroxybehenoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.