Difference between revisions of "3-P-SERINE"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-2001 RXN-2001] == * direction: ** left-to-right * ec-number: ** [http://enzyme.expasy.org/EC/6....") |
(Created page with "Category:metabolite == Metabolite 3-P-SERINE == * common-name: ** 3-phospho-l-serine * smiles: ** c(op([o-])([o-])=o)c([n+])c(=o)[o-] * inchi-key: ** bzqfbwgglxlepq-reohcl...") |
||
(7 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite 3-P-SERINE == |
− | * | + | * common-name: |
− | ** | + | ** 3-phospho-l-serine |
− | * | + | * smiles: |
− | ** | + | ** c(op([o-])([o-])=o)c([n+])c(=o)[o-] |
− | + | * inchi-key: | |
− | + | ** bzqfbwgglxlepq-reohclbhsa-l | |
− | + | * molecular-weight: | |
− | + | ** 183.057 | |
− | * | + | == Reaction(s) known to consume the compound == |
− | ** | + | * [[PSERTRANSAM-RXN]] |
− | * | + | * [[RXN0-5114]] |
− | + | == Reaction(s) known to produce the compound == | |
− | ** | + | * [[PSERTRANSAM-RXN]] |
− | == | + | == Reaction(s) of unknown directionality == |
− | * [[ | + | {{#set: common-name=3-phospho-l-serine}} |
− | + | {{#set: inchi-key=inchikey=bzqfbwgglxlepq-reohclbhsa-l}} | |
− | == | + | {{#set: molecular-weight=183.057}} |
− | * | ||
− | == | ||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | |||
− | |||
− | |||
− |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite 3-P-SERINE
- common-name:
- 3-phospho-l-serine
- smiles:
- c(op([o-])([o-])=o)c([n+])c(=o)[o-]
- inchi-key:
- bzqfbwgglxlepq-reohclbhsa-l
- molecular-weight:
- 183.057