Difference between revisions of "3-Phosphomonucleotides"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8078 == * common-name: ** 1-18:3-2-16:2-monogalactosyldiacylglycerol * smiles: ** ccc=ccc=ccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))o...")
(Created page with "Category:metabolite == Metabolite 3-Phosphomonucleotides == * common-name: ** a ribonucleoside 3'-phosphate == Reaction(s) known to consume the compound == == Reaction(s)...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-8078 ==
+
== Metabolite 3-Phosphomonucleotides ==
 
* common-name:
 
* common-name:
** 1-18:3-2-16:2-monogalactosyldiacylglycerol
+
** a ribonucleoside 3'-phosphate
* smiles:
 
** ccc=ccc=ccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc(cccccc=ccc=cccccc)=o)=o
 
* inchi-key:
 
** wsmybuvbfwdmec-sbpcighssa-n
 
* molecular-weight:
 
** 749.036
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8309]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8299]]
+
* [[3.1.27.1-RXN]]
 +
* [[3.1.27.5-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-18:3-2-16:2-monogalactosyldiacylglycerol}}
+
{{#set: common-name=a ribonucleoside 3'-phosphate}}
{{#set: inchi-key=inchikey=wsmybuvbfwdmec-sbpcighssa-n}}
 
{{#set: molecular-weight=749.036}}
 

Latest revision as of 11:18, 18 March 2021

Metabolite 3-Phosphomonucleotides

  • common-name:
    • a ribonucleoside 3'-phosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality