Difference between revisions of "3-Phosphomonucleotides"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7733 == * common-name: ** aurachin c * smiles: ** cc(c)=cccc(c)=cccc(c)=ccc2(c(c1(c=cc=cc=1n(c(c)=2)o))=o) * inchi-key: ** fihxchbehl...") |
(Created page with "Category:metabolite == Metabolite 3-Phosphomonucleotides == * common-name: ** a ribonucleoside 3'-phosphate == Reaction(s) known to consume the compound == == Reaction(s)...") |
||
(6 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite 3-Phosphomonucleotides == |
* common-name: | * common-name: | ||
− | ** | + | ** a ribonucleoside 3'-phosphate |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[3.1.27.1-RXN]] | ||
+ | * [[3.1.27.5-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a ribonucleoside 3'-phosphate}} |
− | |||
− |
Latest revision as of 11:18, 18 March 2021
Contents
Metabolite 3-Phosphomonucleotides
- common-name:
- a ribonucleoside 3'-phosphate