Difference between revisions of "3-Phosphopolynucleotides"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 13E-11-ALPHA-HYDROXY-915-DIOXOPROST-1 == * common-name: ** (13e)-11-α-hydroxy-9,15-dioxoprost-13-enoate * smiles: ** cccccc(=o)c=cc...") |
(Created page with "Category:metabolite == Metabolite CPD-13401 == * common-name: ** l-alanyl-l-histidine * smiles: ** cc([n+])c(=o)nc(cc1(=cnc=n1))c(=o)[o-] * inchi-key: ** xzwxfwbhyrflef-fs...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-13401 == |
* common-name: | * common-name: | ||
| − | ** | + | ** l-alanyl-l-histidine |
* smiles: | * smiles: | ||
| − | ** | + | ** cc([n+])c(=o)nc(cc1(=cnc=n1))c(=o)[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** xzwxfwbhyrflef-fsplstopsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 226.235 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN0-6978]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=l-alanyl-l-histidine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=xzwxfwbhyrflef-fsplstopsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=226.235}} |
Revision as of 15:30, 5 January 2021
Contents
Metabolite CPD-13401
- common-name:
- l-alanyl-l-histidine
- smiles:
- cc([n+])c(=o)nc(cc1(=cnc=n1))c(=o)[o-]
- inchi-key:
- xzwxfwbhyrflef-fsplstopsa-n
- molecular-weight:
- 226.235
